C24H48O3Si2 — CID 13216820
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclopent-2-en-1-one (PubChem CID 13216820) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclopent-2-en-1-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 13216820 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCC1=CC(=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O3Si2/c1-23(2,3)28(7,8)26-17-15-13-11-12-14-16-20-18-21(25)19-22(20)27-29(9,10)24(4,5)6/h18,22H,11-17,19H2,1-10H3/t22-/m0/s1 |
| InChIKey | OFMRIAGZCRKNBN-QFIPXVFZSA-N |
| XLogP | 7.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|