C16H24O2Si — CID 10564441
4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methylbut-3-en-1-ynyl)cyclopent-2-en-1-one (PubChem CID 10564441) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methylbut-3-en-1-ynyl)cyclopent-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methylbut-3-en-1-ynyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10564441 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methylbut-3-en-1-ynyl)cyclopent-2-en-1-one |
| SMILES | C=C(C)C#CC1=CC(O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C16H24O2Si/c1-12(2)8-9-13-10-14(11-15(13)17)18-19(6,7)16(3,4)5/h10,14H,1,11H2,2-7H3 |
| InChIKey | OILSEKUIPZRXKX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|