C12H21BrO2Si — CID 10566481
(4R)-2-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one (PubChem CID 10566481) has the molecular formula C12H21BrO2Si and a molecular weight of 305.29 g/mol. Its IUPAC name is (4R)-2-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one.
| Compound Name | (4R)-2-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10566481 |
| Molecular Formula | C12H21BrO2Si |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (4R)-2-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(CBr)C(=O)C1 |
| InChI | InChI=1S/C12H21BrO2Si/c1-12(2,3)16(4,5)15-10-6-9(8-13)11(14)7-10/h6,10H,7-8H2,1-5H3/t10-/m0/s1 |
| InChIKey | PVFQRZFWBXWTNH-JTQLQIEISA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|