C20H38O3Si2 — CID 102229156
(4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylcyclopent-2-en-1-one (PubChem CID 102229156) has the molecular formula C20H38O3Si2 and a molecular weight of 382.69 g/mol. Its IUPAC name is (4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 102229156 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CCC1=CC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si2/c1-12-13-15-14-16(21)18(23-25(10,11)20(5,6)7)17(15)22-24(8,9)19(2,3)4/h12,14,17-18H,1,13H2,2-11H3/t17-,18-/m0/s1 |
| InChIKey | YKYSZOCBOUREBB-ROUUACIJSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|