C24H44O5Si2 — CID 134832154
(E,3R,4R)-4-methyl-6-(6-oxo-2,3-dihydropyran-2-yl)-3,4-bis(triethylsilyloxy)hex-5-enal (PubChem CID 134832154) has the molecular formula C24H44O5Si2 and a molecular weight of 468.78 g/mol. Its IUPAC name is (E,3R,4R)-4-methyl-6-(6-oxo-2,3-dihydropyran-2-yl)-3,4-bis(triethylsilyloxy)hex-5-enal.
| Compound Name | (E,3R,4R)-4-methyl-6-(6-oxo-2,3-dihydropyran-2-yl)-3,4-bis(triethylsilyloxy)hex-5-enal |
|---|---|
| PubChem CID | 134832154 |
| Molecular Formula | C24H44O5Si2 |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (E,3R,4R)-4-methyl-6-(6-oxo-2,3-dihydropyran-2-yl)-3,4-bis(triethylsilyloxy)hex-5-enal |
| SMILES | CC[Si](CC)(CC)O[C@H](CC=O)[C@@](C)(/C=C/C1CC=CC(=O)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H44O5Si2/c1-8-30(9-2,10-3)28-22(18-20-25)24(7,29-31(11-4,12-5)13-6)19-17-21-15-14-16-23(26)27-21/h14,16-17,19-22H,8-13,15,18H2,1-7H3/b19-17+/t21?,22-,24-/m1/s1 |
| InChIKey | JIBQOFLQHUQTMR-LKARBFKKSA-N |
| XLogP | 6.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|