C26H44O5Si2 — CID 134831938
2-[(E,3R,4R)-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)oct-1-en-7-ynyl]-2,3-dihydropyran-6-one (PubChem CID 134831938) has the molecular formula C26H44O5Si2 and a molecular weight of 492.81 g/mol. Its IUPAC name is 2-[(E,3R,4R)-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)oct-1-en-7-ynyl]-2,3-dihydropyran-6-one.
| Compound Name | 2-[(E,3R,4R)-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)oct-1-en-7-ynyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 134831938 |
| Molecular Formula | C26H44O5Si2 |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[(E,3R,4R)-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)oct-1-en-7-ynyl]-2,3-dihydropyran-6-one |
| SMILES | C#CC(=O)C[C@@H](O[Si](CC)(CC)CC)[C@@](C)(/C=C/C1CC=CC(=O)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H44O5Si2/c1-9-22(27)21-24(30-32(10-2,11-3)12-4)26(8,31-33(13-5,14-6)15-7)20-19-23-17-16-18-25(28)29-23/h1,16,18-20,23-24H,10-15,17,21H2,2-8H3/b20-19+/t23?,24-,26-/m1/s1 |
| InChIKey | XDABYXNZESOPLO-HOMBNQINSA-N |
| XLogP | 6.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|