C30H60O5Si3 — CID 46933711
ethyl (E,4R,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5-bis(triethylsilyloxy)non-2-en-8-ynoate (PubChem CID 46933711) has the molecular formula C30H60O5Si3 and a molecular weight of 585.06 g/mol. Its IUPAC name is ethyl (E,4R,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5-bis(triethylsilyloxy)non-2-en-8-ynoate.
| Compound Name | ethyl (E,4R,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5-bis(triethylsilyloxy)non-2-en-8-ynoate |
|---|---|
| PubChem CID | 46933711 |
| Molecular Formula | C30H60O5Si3 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | ethyl (E,4R,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4,5-bis(triethylsilyloxy)non-2-en-8-ynoate |
| SMILES | C#C[C@@H](C[C@@H](O[Si](CC)(CC)CC)[C@@](C)(/C=C/C(=O)OCC)O[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O5Si3/c1-15-26(33-36(13,14)29(9,10)11)25-27(34-37(17-3,18-4)19-5)30(12,24-23-28(31)32-16-2)35-38(20-6,21-7)22-8/h1,23-24,26-27H,16-22,25H2,2-14H3/b24-23+/t26-,27+,30+/m0/s1 |
| InChIKey | AOLONODQJTVAFY-HKWRZXGVSA-N |
| XLogP | 8.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|