C32H58O4Si2 — CID 122375846
[(2R,3S)-3-methyloct-6-yn-2-yl] (E,4R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4-triethylsilyloxydec-2-en-8-ynoate (PubChem CID 122375846) has the molecular formula C32H58O4Si2 and a molecular weight of 562.98 g/mol. Its IUPAC name is [(2R,3S)-3-methyloct-6-yn-2-yl] (E,4R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4-triethylsilyloxydec-2-en-8-ynoate.
| Compound Name | [(2R,3S)-3-methyloct-6-yn-2-yl] (E,4R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4-triethylsilyloxydec-2-en-8-ynoate |
|---|---|
| PubChem CID | 122375846 |
| Molecular Formula | C32H58O4Si2 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | [(2R,3S)-3-methyloct-6-yn-2-yl] (E,4R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-4-triethylsilyloxydec-2-en-8-ynoate |
| SMILES | CC#CCC[C@H](C)[C@@H](C)OC(=O)/C=C/[C@@](C)(CC[C@@H](C#CC)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H58O4Si2/c1-14-19-20-22-27(6)28(7)34-30(33)24-26-32(11,36-38(16-3,17-4)18-5)25-23-29(21-15-2)35-37(12,13)31(8,9)10/h24,26-29H,16-18,20,22-23,25H2,1-13H3/b26-24+/t27-,28+,29+,32+/m0/s1 |
| InChIKey | CHVGVPZNJIVWHQ-NCGHNODESA-N |
| XLogP | 8.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|