C24H48O4Si2 — CID 177448571
methyl (2Z,5R,6S,7S,8E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dienoate (PubChem CID 177448571) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is methyl (2Z,5R,6S,7S,8E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dienoate.
| Compound Name | methyl (2Z,5R,6S,7S,8E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dienoate |
|---|---|
| PubChem CID | 177448571 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | methyl (2Z,5R,6S,7S,8E)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyldeca-2,8-dienoate |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C/C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O4Si2/c1-14-16-20(27-29(10,11)23(3,4)5)19(2)21(17-15-18-22(25)26-9)28-30(12,13)24(6,7)8/h14-16,18-21H,17H2,1-13H3/b16-14+,18-15-/t19-,20+,21-/m1/s1 |
| InChIKey | NTKZVJHQXKCYMA-ANLNGJGKSA-N |
| XLogP | 7.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|