C28H52O4Si2 — CID 122375848
(3E,5R,8S,13S,14R)-8-[tert-butyl(dimethyl)silyl]oxy-5,13,14-trimethyl-5-triethylsilyloxy-1-oxacyclotetradec-3-en-9-yn-2-one (PubChem CID 122375848) has the molecular formula C28H52O4Si2 and a molecular weight of 508.89 g/mol. Its IUPAC name is (3E,5R,8S,13S,14R)-8-[tert-butyl(dimethyl)silyl]oxy-5,13,14-trimethyl-5-triethylsilyloxy-1-oxacyclotetradec-3-en-9-yn-2-one.
| Compound Name | (3E,5R,8S,13S,14R)-8-[tert-butyl(dimethyl)silyl]oxy-5,13,14-trimethyl-5-triethylsilyloxy-1-oxacyclotetradec-3-en-9-yn-2-one |
|---|---|
| PubChem CID | 122375848 |
| Molecular Formula | C28H52O4Si2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | (3E,5R,8S,13S,14R)-8-[tert-butyl(dimethyl)silyl]oxy-5,13,14-trimethyl-5-triethylsilyloxy-1-oxacyclotetradec-3-en-9-yn-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)/C=C/C(=O)O[C@H](C)[C@@H](C)CCC#C[C@@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C28H52O4Si2/c1-12-34(13-2,14-3)32-28(9)21-19-25(31-33(10,11)27(6,7)8)18-16-15-17-23(4)24(5)30-26(29)20-22-28/h20,22-25H,12-15,17,19,21H2,1-11H3/b22-20+/t23-,24+,25+,28+/m0/s1 |
| InChIKey | TYKAFJICNNUHEF-YKLSSPCMSA-N |
| XLogP | 7.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|