C18H28O5 — CID 177475541
(4S,5R,8E,10R)-10-hydroxy-13-methoxy-4,5,10,14-tetramethyl-6,15-dioxabicyclo[12.1.0]pentadeca-8,11-dien-7-one (PubChem CID 177475541) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4S,5R,8E,10R)-10-hydroxy-13-methoxy-4,5,10,14-tetramethyl-6,15-dioxabicyclo[12.1.0]pentadeca-8,11-dien-7-one.
| Compound Name | (4S,5R,8E,10R)-10-hydroxy-13-methoxy-4,5,10,14-tetramethyl-6,15-dioxabicyclo[12.1.0]pentadeca-8,11-dien-7-one |
|---|---|
| PubChem CID | 177475541 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (4S,5R,8E,10R)-10-hydroxy-13-methoxy-4,5,10,14-tetramethyl-6,15-dioxabicyclo[12.1.0]pentadeca-8,11-dien-7-one |
| SMILES | COC1C=C[C@@](C)(O)/C=C/C(=O)O[C@H](C)[C@@H](C)CCC2OC12C |
| InChI | InChI=1S/C18H28O5/c1-12-6-7-15-18(4,23-15)14(21-5)8-10-17(3,20)11-9-16(19)22-13(12)2/h8-15,20H,6-7H2,1-5H3/b10-8?,11-9+/t12-,13+,14?,15?,17+,18?/m0/s1 |
| InChIKey | DWPSZWXJNGIASS-ZXIAJEBDSA-N |
| XLogP | 2.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|