C18H30O4 — CID 10615177
(5S,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one (PubChem CID 10615177) has the molecular formula C18H30O4 and a molecular weight of 314.40 g/mol. Its IUPAC name is (5S,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one.
| Compound Name | (5S,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one |
|---|---|
| PubChem CID | 10615177 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (5S,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-6,9-dien-2-one |
| SMILES | CO[C@H]1/C=[13CH]/[C@@](C)(O)CC[13C](=O)O[13C@H](C)[C@@H](C)CC/[13CH]=C/1C |
| InChI | InChI=1S/C18H30O4/c1-13-7-6-8-14(2)16(21-5)9-11-18(4,20)12-10-17(19)22-15(13)3/h8-9,11,13,15-16,20H,6-7,10,12H2,1-5H3/b11-9+,14-8+/t13-,15+,16-,18+/m0/s1/i8+1,11+1,15+1,17+1 |
| InChIKey | XIHUXEHAQPSMTF-VTTDJBBNSA-N |
| XLogP | 3.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|