C18H28O5 — CID 163179942
5,10-dihydroxy-8-methoxy-5,13,14-trimethyl-9-methylidene-1-oxacyclotetradeca-3,6-dien-2-one (PubChem CID 163179942) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is 5,10-dihydroxy-8-methoxy-5,13,14-trimethyl-9-methylidene-1-oxacyclotetradeca-3,6-dien-2-one.
| Compound Name | 5,10-dihydroxy-8-methoxy-5,13,14-trimethyl-9-methylidene-1-oxacyclotetradeca-3,6-dien-2-one |
|---|---|
| PubChem CID | 163179942 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 5,10-dihydroxy-8-methoxy-5,13,14-trimethyl-9-methylidene-1-oxacyclotetradeca-3,6-dien-2-one |
| SMILES | C=C1C(O)CCC(C)C(C)OC(=O)C=CC(C)(O)C=CC1OC |
| InChI | InChI=1S/C18H28O5/c1-12-6-7-15(19)13(2)16(22-5)8-10-18(4,21)11-9-17(20)23-14(12)3/h8-12,14-16,19,21H,2,6-7H2,1,3-5H3 |
| InChIKey | YSCUFWGWXDIJNP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|