C27H54O6Si3 — CID 102050768
(7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-one (PubChem CID 102050768) has the molecular formula C27H54O6Si3 and a molecular weight of 558.98 g/mol. Its IUPAC name is (7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-one.
| Compound Name | (7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-one |
|---|---|
| PubChem CID | 102050768 |
| Molecular Formula | C27H54O6Si3 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | (7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-one |
| SMILES | CC[Si](CC)(CC)O[C@@]1(CO[Si](C)(C)C(C)(C)C)C(=O)C2(C=C[C@H]1O[Si](C)(C)C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C27H54O6Si3/c1-14-36(15-2,16-3)33-26(21-31-34(10,11)24(4,5)6)22(32-35(12,13)25(7,8)9)17-18-27(23(26)28)29-19-20-30-27/h17-18,22H,14-16,19-21H2,1-13H3/t22-,26-/m1/s1 |
| InChIKey | IEZXQCHYTXPZNR-ATIYNZHBSA-N |
| XLogP | 7.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|