C27H50O4Si2 — CID 101154494
tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-dien-3-yl]oxy]-dimethylsilane (PubChem CID 101154494) has the molecular formula C27H50O4Si2 and a molecular weight of 494.87 g/mol. Its IUPAC name is tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-dien-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-dien-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101154494 |
| Molecular Formula | C27H50O4Si2 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-dien-3-yl]oxy]-dimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@]12CCCC=C1/C=C\[C@H]1OC(C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C27H50O4Si2/c1-11-33(12-2,13-3)31-27-19-15-14-16-21(27)17-18-22-24(29-26(7,8)28-22)23(20-27)30-32(9,10)25(4,5)6/h16-18,22-24H,11-15,19-20H2,1-10H3/b18-17-/t22-,23+,24-,27+/m1/s1 |
| InChIKey | HXOIOVSFLLPWJT-PPCAHFALSA-N |
| XLogP | 7.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|