C40H78O6Si3 — CID 54455516
(12R,16S)-8,9,17-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol (PubChem CID 54455516) has the molecular formula C40H78O6Si3 and a molecular weight of 739.32 g/mol. Its IUPAC name is (12R,16S)-8,9,17-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol.
| Compound Name | (12R,16S)-8,9,17-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol |
|---|---|
| PubChem CID | 54455516 |
| Molecular Formula | C40H78O6Si3 |
| Molecular Weight | 739.32 g/mol |
| Exact Mass | 738.51 |
| IUPAC Name | (12R,16S)-8,9,17-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-14-ol |
| SMILES | CC1(C)OC2C(O1)C1C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC[C@]1(C)C1C(O)C[C@]3(C)C(O[Si](C)(C)C(C)(C)C)CCC3C21 |
| InChI | InChI=1S/C40H78O6Si3/c1-35(2,3)47(14,15)44-27-22-23-39(12)30-26(41)24-40(13)25(20-21-28(40)45-48(16,17)36(4,5)6)29(30)33-34(43-38(10,11)42-33)31(39)32(27)46-49(18,19)37(7,8)9/h25-34,41H,20-24H2,1-19H3/t25?,26?,27?,28?,29?,30?,31?,32?,33?,34?,39-,40+/m1/s1 |
| InChIKey | WXXRLJPTEONERY-JWQASVJGSA-N |
| XLogP | 10.52 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.32 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|