C17H32O5Si — CID 11573754
(2'S,3aS,4R,6R,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-ol (PubChem CID 11573754) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is (2'S,3aS,4R,6R,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-ol.
| Compound Name | (2'S,3aS,4R,6R,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-ol |
|---|---|
| PubChem CID | 11573754 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (2'S,3aS,4R,6R,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclopentane]-6-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)O[C@]3(CCC[C@@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C17H32O5Si/c1-15(2,3)23(6,7)22-11-9-8-10-17(11)13-12(14(18)21-17)19-16(4,5)20-13/h11-14,18H,8-10H2,1-7H3/t11-,12+,13-,14+,17-/m0/s1 |
| InChIKey | FJYPSOJWWPWOKH-TVRNETQVSA-N |
| XLogP | 3.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|