C18H34O3Si — CID 11336367
(1R,5S,6R,9R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-11-oxatricyclo[7.2.1.01,6]dodecan-10-ol (PubChem CID 11336367) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (1R,5S,6R,9R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-11-oxatricyclo[7.2.1.01,6]dodecan-10-ol.
| Compound Name | (1R,5S,6R,9R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-11-oxatricyclo[7.2.1.01,6]dodecan-10-ol |
|---|---|
| PubChem CID | 11336367 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (1R,5S,6R,9R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-11-oxatricyclo[7.2.1.01,6]dodecan-10-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@]23C[C@@H](CC[C@]12C)C(O)O3 |
| InChI | InChI=1S/C18H34O3Si/c1-16(2,3)22(5,6)21-14-8-7-10-18-12-13(15(19)20-18)9-11-17(14,18)4/h13-15,19H,7-12H2,1-6H3/t13-,14+,15?,17-,18-/m1/s1 |
| InChIKey | YNHOQGQLPNMPLC-BIRPOOPVSA-N |
| XLogP | 4.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|