C25H46O4Si2 — CID 11027024
(1R,2R,5S,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-12-oxatricyclo[6.3.1.01,6]dodec-9-en-11-one (PubChem CID 11027024) has the molecular formula C25H46O4Si2 and a molecular weight of 466.81 g/mol. Its IUPAC name is (1R,2R,5S,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-12-oxatricyclo[6.3.1.01,6]dodec-9-en-11-one.
| Compound Name | (1R,2R,5S,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-12-oxatricyclo[6.3.1.01,6]dodec-9-en-11-one |
|---|---|
| PubChem CID | 11027024 |
| Molecular Formula | C25H46O4Si2 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (1R,2R,5S,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-12-oxatricyclo[6.3.1.01,6]dodec-9-en-11-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C[C@@H]3C=CC(=O)[C@@]12O3 |
| InChI | InChI=1S/C25H46O4Si2/c1-22(2,3)30(8,9)27-17-18-12-15-21(29-31(10,11)23(4,5)6)24(7)16-19-13-14-20(26)25(18,24)28-19/h13-14,18-19,21H,12,15-17H2,1-11H3/t18-,19+,21+,24-,25+/m1/s1 |
| InChIKey | HUXBHUHMMWMJQL-KHJRNCMUSA-N |
| XLogP | 6.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|