C29H60O4Si3 — CID 177385706
(1S,4S,4aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-4a-trimethylsilyloxy-1,2,3,4,5,6,8,9-octahydrobenzo[7]annulen-7-one (PubChem CID 177385706) has the molecular formula C29H60O4Si3 and a molecular weight of 557.05 g/mol. Its IUPAC name is (1S,4S,4aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-4a-trimethylsilyloxy-1,2,3,4,5,6,8,9-octahydrobenzo[7]annulen-7-one.
| Compound Name | (1S,4S,4aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-4a-trimethylsilyloxy-1,2,3,4,5,6,8,9-octahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 177385706 |
| Molecular Formula | C29H60O4Si3 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | (1S,4S,4aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a-dimethyl-4a-trimethylsilyloxy-1,2,3,4,5,6,8,9-octahydrobenzo[7]annulen-7-one |
| SMILES | CC1C[C@@]2(O[Si](C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)CCC1=O |
| InChI | InChI=1S/C29H60O4Si3/c1-22-20-29(33-34(9,10)11)23(21-31-35(12,13)26(2,3)4)16-17-25(28(29,8)19-18-24(22)30)32-36(14,15)27(5,6)7/h22-23,25H,16-21H2,1-15H3/t22?,23-,25-,28-,29+/m0/s1 |
| InChIKey | FVTZRGRMUXBUSZ-LVEVBQGVSA-N |
| XLogP | 8.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|