C32H62O3Si2 — CID 158698275
(3aS,4R,5S,7aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one (PubChem CID 158698275) has the molecular formula C32H62O3Si2 and a molecular weight of 551.02 g/mol. Its IUPAC name is (3aS,4R,5S,7aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one.
| Compound Name | (3aS,4R,5S,7aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 158698275 |
| Molecular Formula | C32H62O3Si2 |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.42 |
| IUPAC Name | (3aS,4R,5S,7aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one |
| SMILES | C[C@H]1CC[C@](C)([C@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H62O3Si2/c1-23-16-18-31(8,24(20-23)21-34-36(10,11)29(2,3)4)27-17-19-32(9)26(14-15-28(32)33)25(27)22-35-37(12,13)30(5,6)7/h23-27H,14-22H2,1-13H3/t23-,24+,25-,26-,27-,31-,32-/m0/s1 |
| InChIKey | RIOJNIPJEQILLT-RAUUDXAVSA-N |
| XLogP | 9.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|