C37H54O2Si — CID 162214905
[(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methanol (PubChem CID 162214905) has the molecular formula C37H54O2Si and a molecular weight of 558.92 g/mol. Its IUPAC name is [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methanol.
| Compound Name | [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 162214905 |
| Molecular Formula | C37H54O2Si |
| Molecular Weight | 558.92 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methanol |
| SMILES | C=C1CC[C@H]2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]([C@@]3(C)CC[C@H](C)C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C37H54O2Si/c1-27-20-22-37(7,29(24-27)25-38)34-21-23-36(6)28(2)18-19-33(36)32(34)26-39-40(35(3,4)5,30-14-10-8-11-15-30)31-16-12-9-13-17-31/h8-17,27,29,32-34,38H,2,18-26H2,1,3-7H3/t27-,29+,32-,33-,34-,36+,37-/m0/s1 |
| InChIKey | WFOGERNABKRSJQ-HZRACAIPSA-N |
| XLogP | 8.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.92 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|