C21H34N6 — CID 118969600
(3aS,6S,7R,7aS)-7-(azidomethyl)-6-[(1R,2S,4S)-2-(azidomethyl)-1,4-dimethylcyclohexyl]-3a-methyl-3-methylidene-2,4,5,6,7,7a-hexahydro-1H-indene (PubChem CID 118969600) has the molecular formula C21H34N6 and a molecular weight of 370.55 g/mol. Its IUPAC name is (3aS,6S,7R,7aS)-7-(azidomethyl)-6-[(1R,2S,4S)-2-(azidomethyl)-1,4-dimethylcyclohexyl]-3a-methyl-3-methylidene-2,4,5,6,7,7a-hexahydro-1H-indene.
| Compound Name | (3aS,6S,7R,7aS)-7-(azidomethyl)-6-[(1R,2S,4S)-2-(azidomethyl)-1,4-dimethylcyclohexyl]-3a-methyl-3-methylidene-2,4,5,6,7,7a-hexahydro-1H-indene |
|---|---|
| PubChem CID | 118969600 |
| Molecular Formula | C21H34N6 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | (3aS,6S,7R,7aS)-7-(azidomethyl)-6-[(1R,2S,4S)-2-(azidomethyl)-1,4-dimethylcyclohexyl]-3a-methyl-3-methylidene-2,4,5,6,7,7a-hexahydro-1H-indene |
| SMILES | C=C1CC[C@H]2[C@H](CN=[N+]=[N-])[C@@H]([C@@]3(C)CC[C@H](C)C[C@@H]3CN=[N+]=[N-])CC[C@]12C |
| InChI | InChI=1S/C21H34N6/c1-14-7-9-21(4,16(11-14)12-24-26-22)19-8-10-20(3)15(2)5-6-18(20)17(19)13-25-27-23/h14,16-19H,2,5-13H2,1,3-4H3/t14-,16+,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | ICTJDOPIGXBMBE-OSBZKKERSA-N |
| XLogP | 7.05 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|