C25H41N3O2 — CID 58103828
[(1S,2R,5S)-2-[(1R,4S,7aS)-4-(azidomethyl)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate (PubChem CID 58103828) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is [(1S,2R,5S)-2-[(1R,4S,7aS)-4-(azidomethyl)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate.
| Compound Name | [(1S,2R,5S)-2-[(1R,4S,7aS)-4-(azidomethyl)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 58103828 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | [(1S,2R,5S)-2-[(1R,4S,7aS)-4-(azidomethyl)-7a-methyl-1-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate |
| SMILES | C=C(C)[C@H]1CCC2[C@H](CN=[N+]=[N-])C([C@@]3(C)CC[C@H](C)C[C@@H]3COC(C)=O)CC[C@@]21C |
| InChI | InChI=1S/C25H41N3O2/c1-16(2)21-7-8-22-20(14-27-28-26)23(10-12-25(21,22)6)24(5)11-9-17(3)13-19(24)15-30-18(4)29/h17,19-23H,1,7-15H2,2-6H3/t17-,19+,20-,21+,22?,23?,24-,25+/m0/s1 |
| InChIKey | IYRUDTFHAQSRLA-LJVUOHNOSA-N |
| XLogP | 6.94 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|