C20H31N3O2 — CID 173483399
(1S,2R,5S)-2-[(4R,7aS)-4-(azidomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-hydroxy-2-methylcyclohexane-1-carbaldehyde (PubChem CID 173483399) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (1S,2R,5S)-2-[(4R,7aS)-4-(azidomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-hydroxy-2-methylcyclohexane-1-carbaldehyde.
| Compound Name | (1S,2R,5S)-2-[(4R,7aS)-4-(azidomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-hydroxy-2-methylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 173483399 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (1S,2R,5S)-2-[(4R,7aS)-4-(azidomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-hydroxy-2-methylcyclohexane-1-carbaldehyde |
| SMILES | C=C1CCC2[C@H](CN=[N+]=[N-])C([C@@]3(C)CC[C@H](O)C[C@@H]3C=O)CC[C@]12C |
| InChI | InChI=1S/C20H31N3O2/c1-13-4-5-17-16(11-22-23-21)18(7-9-19(13,17)2)20(3)8-6-15(25)10-14(20)12-24/h12,14-18,25H,1,4-11H2,2-3H3/t14-,15+,16+,17?,18?,19-,20+/m1/s1 |
| InChIKey | CWUHHRHRDBBPEV-RFZKYFRTSA-N |
| XLogP | 4.66 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|