C26H37NO2 — CID 66838195
4-[4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyridin-3-ylethenyl)cyclohexan-1-ol (PubChem CID 66838195) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyridin-3-ylethenyl)cyclohexan-1-ol.
| Compound Name | 4-[4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyridin-3-ylethenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 66838195 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 4-[4-(hydroxymethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyridin-3-ylethenyl)cyclohexan-1-ol |
| SMILES | C=C1CCC2C(CO)C(C3(C)CCC(O)CC3C=Cc3cccnc3)CCC12C |
| InChI | InChI=1S/C26H37NO2/c1-18-6-9-23-22(17-28)24(11-13-25(18,23)2)26(3)12-10-21(29)15-20(26)8-7-19-5-4-14-27-16-19/h4-5,7-8,14,16,20-24,28-29H,1,6,9-13,15,17H2,2-3H3 |
| InChIKey | VVDRAWQLONDABJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|