C25H37N3O3 — CID 86267452
N-[[(3aS,4R,5S,7aS)-5-[(1R,2S,4S)-4-hydroxy-2-(hydroxymethyl)-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl]pyrazine-2-carboxamide (PubChem CID 86267452) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[[(3aS,4R,5S,7aS)-5-[(1R,2S,4S)-4-hydroxy-2-(hydroxymethyl)-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[(3aS,4R,5S,7aS)-5-[(1R,2S,4S)-4-hydroxy-2-(hydroxymethyl)-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 86267452 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | N-[[(3aS,4R,5S,7aS)-5-[(1R,2S,4S)-4-hydroxy-2-(hydroxymethyl)-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl]pyrazine-2-carboxamide |
| SMILES | C=C1CC[C@H]2[C@H](CNC(=O)c3cnccn3)[C@@H]([C@@]3(C)CC[C@H](O)C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C25H37N3O3/c1-16-4-5-20-19(13-28-23(31)22-14-26-10-11-27-22)21(7-9-24(16,20)2)25(3)8-6-18(30)12-17(25)15-29/h10-11,14,17-21,29-30H,1,4-9,12-13,15H2,2-3H3,(H,28,31)/t17-,18+,19+,20+,21+,24-,25+/m1/s1 |
| InChIKey | CYUGEIFEVDAQOF-XUZFWGHHSA-N |
| XLogP | 3.36 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|