C23H42N2O2 — CID 66838165
4-[4-[[2-(dimethylamino)ethylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol (PubChem CID 66838165) has the molecular formula C23H42N2O2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 4-[4-[[2-(dimethylamino)ethylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol.
| Compound Name | 4-[4-[[2-(dimethylamino)ethylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 66838165 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 4-[4-[[2-(dimethylamino)ethylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
| SMILES | C=C1CCC2C(CNCCN(C)C)C(C3(C)CCC(O)CC3O)CCC12C |
| InChI | InChI=1S/C23H42N2O2/c1-16-6-7-19-18(15-24-12-13-25(4)5)20(9-11-22(16,19)2)23(3)10-8-17(26)14-21(23)27/h17-21,24,26-27H,1,6-15H2,2-5H3 |
| InChIKey | XRLXBUOZDQXAIR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|