C26H39NO2 — CID 11176962
(1S,3S,4R)-4-[(4R,7aR)-4-[(benzylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol (PubChem CID 11176962) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(4R,7aR)-4-[(benzylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol.
| Compound Name | (1S,3S,4R)-4-[(4R,7aR)-4-[(benzylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11176962 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (1S,3S,4R)-4-[(4R,7aR)-4-[(benzylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
| SMILES | C=C1CCC2[C@@H](CNCc3ccccc3)C([C@@]3(C)CC[C@H](O)C[C@@H]3O)CC[C@@]12C |
| InChI | InChI=1S/C26H39NO2/c1-18-9-10-22-21(17-27-16-19-7-5-4-6-8-19)23(12-14-25(18,22)2)26(3)13-11-20(28)15-24(26)29/h4-8,20-24,27-29H,1,9-17H2,2-3H3/t20-,21+,22?,23?,24-,25-,26+/m0/s1 |
| InChIKey | BCDGKWDGXXICNE-ZIPRBDFTSA-N |
| XLogP | 4.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|