C19H32O4 — CID 122536963
(1S,3S,4R)-4-[(4R,7aS)-4-(hydroxymethoxy)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol (PubChem CID 122536963) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(4R,7aS)-4-(hydroxymethoxy)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol.
| Compound Name | (1S,3S,4R)-4-[(4R,7aS)-4-(hydroxymethoxy)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 122536963 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (1S,3S,4R)-4-[(4R,7aS)-4-(hydroxymethoxy)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
| SMILES | C=C1CCC2[C@@H](OCO)C([C@@]3(C)CC[C@H](O)C[C@@H]3O)CC[C@]12C |
| InChI | InChI=1S/C19H32O4/c1-12-4-5-14-17(23-11-20)15(7-9-18(12,14)2)19(3)8-6-13(21)10-16(19)22/h13-17,20-22H,1,4-11H2,2-3H3/t13-,14?,15?,16-,17+,18+,19+/m0/s1 |
| InChIKey | UYDGIDSGWCRWRY-UWOBYKIKSA-N |
| XLogP | 2.62 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|