C22H36Cl2O3 — CID 129044642
(1S,3S,4S)-4-[(4R,7aS)-1-(dichloromethylidene)-4-(hydroxymethoxy)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexan-1-ol (PubChem CID 129044642) has the molecular formula C22H36Cl2O3 and a molecular weight of 419.43 g/mol. Its IUPAC name is (1S,3S,4S)-4-[(4R,7aS)-1-(dichloromethylidene)-4-(hydroxymethoxy)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexan-1-ol.
| Compound Name | (1S,3S,4S)-4-[(4R,7aS)-1-(dichloromethylidene)-4-(hydroxymethoxy)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 129044642 |
| Molecular Formula | C22H36Cl2O3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (1S,3S,4S)-4-[(4R,7aS)-1-(dichloromethylidene)-4-(hydroxymethoxy)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexan-1-ol |
| SMILES | CCC[C@H]1C[C@@H](O)CC[C@]1(C)C1CC[C@]2(C)C(=C(Cl)Cl)CCC2[C@@H]1OCO |
| InChI | InChI=1S/C22H36Cl2O3/c1-4-5-14-12-15(26)8-10-21(14,2)17-9-11-22(3)16(19(17)27-13-25)6-7-18(22)20(23)24/h14-17,19,25-26H,4-13H2,1-3H3/t14-,15-,16?,17?,19-,21-,22-/m0/s1 |
| InChIKey | VEXYEDJFOGVQJR-JBOLMBOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|