C23H35N3O4 — CID 90424438
[(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-4-hydroxy-1-methyl-2-[2-(1,2,4-triazol-1-yl)ethyl]cyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate (PubChem CID 90424438) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-4-hydroxy-1-methyl-2-[2-(1,2,4-triazol-1-yl)ethyl]cyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate.
| Compound Name | [(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-4-hydroxy-1-methyl-2-[2-(1,2,4-triazol-1-yl)ethyl]cyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 90424438 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | [(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-4-hydroxy-1-methyl-2-[2-(1,2,4-triazol-1-yl)ethyl]cyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@]2(C)CC[C@H](O)C[C@@H]2CCn2cncn2)CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H35N3O4/c1-15(27)30-21-18-4-5-20(29)23(18,3)10-7-19(21)22(2)9-6-17(28)12-16(22)8-11-26-14-24-13-25-26/h13-14,16-19,21,28H,4-12H2,1-3H3/t16-,17-,18-,19-,21-,22-,23-/m0/s1 |
| InChIKey | SCQFTPINMJERAZ-ONCXAFAASA-N |
| XLogP | 3.16 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |