C25H39NO5 — CID 123708988
[4-(4-acetyloxy-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(3-amino-3-oxopropyl)-4-methylcyclohexyl] acetate (PubChem CID 123708988) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is [4-(4-acetyloxy-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(3-amino-3-oxopropyl)-4-methylcyclohexyl] acetate.
| Compound Name | [4-(4-acetyloxy-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(3-amino-3-oxopropyl)-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 123708988 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [4-(4-acetyloxy-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(3-amino-3-oxopropyl)-4-methylcyclohexyl] acetate |
| SMILES | C=C1CCC2C(OC(C)=O)C(C3(C)CCC(OC(C)=O)CC3CCC(N)=O)CCC12C |
| InChI | InChI=1S/C25H39NO5/c1-15-6-8-20-23(31-17(3)28)21(11-13-24(15,20)4)25(5)12-10-19(30-16(2)27)14-18(25)7-9-22(26)29/h18-21,23H,1,6-14H2,2-5H3,(H2,26,29) |
| InChIKey | YWTNAFGEBOXQPD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|