C28H45NO4 — CID 147607440
[(1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-4-(2-pyrrolidin-1-ylethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-acetyloxy-4-methylcyclohexyl] acetate (PubChem CID 147607440) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is [(1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-4-(2-pyrrolidin-1-ylethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-acetyloxy-4-methylcyclohexyl] acetate.
| Compound Name | [(1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-4-(2-pyrrolidin-1-ylethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-acetyloxy-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 147607440 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | [(1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-4-(2-pyrrolidin-1-ylethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-acetyloxy-4-methylcyclohexyl] acetate |
| SMILES | C=C1CCC2C(CCN3CCCC3)C([C@@]3(C)CC[C@H](OC(C)=O)C[C@@H]3OC(C)=O)CC[C@]12C |
| InChI | InChI=1S/C28H45NO4/c1-19-8-9-24-23(12-17-29-15-6-7-16-29)25(11-14-27(19,24)4)28(5)13-10-22(32-20(2)30)18-26(28)33-21(3)31/h22-26H,1,6-18H2,2-5H3/t22-,23?,24?,25?,26-,27+,28+/m0/s1 |
| InChIKey | GBIKJGJQOFHITC-MZZCCCJQSA-N |
| XLogP | 5.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|