C27H45NO2 — CID 58103711
[(4R,7aS)-5-[(1R,2S,4S)-1,4-dimethyl-2-(pyrrolidin-1-ylmethyl)cyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl acetate (PubChem CID 58103711) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is [(4R,7aS)-5-[(1R,2S,4S)-1,4-dimethyl-2-(pyrrolidin-1-ylmethyl)cyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl acetate.
| Compound Name | [(4R,7aS)-5-[(1R,2S,4S)-1,4-dimethyl-2-(pyrrolidin-1-ylmethyl)cyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl acetate |
|---|---|
| PubChem CID | 58103711 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | [(4R,7aS)-5-[(1R,2S,4S)-1,4-dimethyl-2-(pyrrolidin-1-ylmethyl)cyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methyl acetate |
| SMILES | C=C1CCC2[C@H](COC(C)=O)C([C@@]3(C)CC[C@H](C)C[C@@H]3CN3CCCC3)CC[C@]12C |
| InChI | InChI=1S/C27H45NO2/c1-19-10-12-27(5,22(16-19)17-28-14-6-7-15-28)25-11-13-26(4)20(2)8-9-24(26)23(25)18-30-21(3)29/h19,22-25H,2,6-18H2,1,3-5H3/t19-,22+,23-,24?,25?,26+,27-/m0/s1 |
| InChIKey | QNUWFMWSQQVJOE-UOOQUPESSA-N |
| XLogP | 6.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|