C24H39NO3 — CID 118969632
[(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[(Z)-methoxyiminomethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate (PubChem CID 118969632) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[(Z)-methoxyiminomethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate.
| Compound Name | [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[(Z)-methoxyiminomethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 118969632 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | [(1S,2R,5S)-2-[(3aS,4R,5S,7aS)-4-[(Z)-methoxyiminomethyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2,5-dimethylcyclohexyl]methyl acetate |
| SMILES | C=C1CC[C@H]2[C@H](/C=N\OC)[C@@H]([C@@]3(C)CC[C@H](C)C[C@@H]3COC(C)=O)CC[C@]12C |
| InChI | InChI=1S/C24H39NO3/c1-16-9-11-24(5,19(13-16)15-28-18(3)26)22-10-12-23(4)17(2)7-8-21(23)20(22)14-25-27-6/h14,16,19-22H,2,7-13,15H2,1,3-6H3/b25-14-/t16-,19+,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | FTPUCRTZAGVDKZ-HEOYTXRXSA-N |
| XLogP | 5.62 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|