C23H38O2 — CID 122536997
[(3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexyl] acetate (PubChem CID 122536997) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is [(3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexyl] acetate.
| Compound Name | [(3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexyl] acetate |
|---|---|
| PubChem CID | 122536997 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | [(3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-propylcyclohexyl] acetate |
| SMILES | C=C1CCC2CC([C@@]3(C)CCC(OC(C)=O)C[C@@H]3CCC)CC[C@]12C |
| InChI | InChI=1S/C23H38O2/c1-6-7-18-15-21(25-17(3)24)11-13-23(18,5)20-10-12-22(4)16(2)8-9-19(22)14-20/h18-21H,2,6-15H2,1,3-5H3/t18-,19?,20?,21?,22+,23-/m0/s1 |
| InChIKey | ITJFPHUKIZTGSN-WQRAGHDLSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|