C22H40O2 — CID 142951401
(1S,3S,4R)-4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(2-hydroxyethyl)-4-methylcyclohexan-1-ol;ethane (PubChem CID 142951401) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (1S,3S,4R)-4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(2-hydroxyethyl)-4-methylcyclohexan-1-ol;ethane.
| Compound Name | (1S,3S,4R)-4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(2-hydroxyethyl)-4-methylcyclohexan-1-ol;ethane |
|---|---|
| PubChem CID | 142951401 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (1S,3S,4R)-4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(2-hydroxyethyl)-4-methylcyclohexan-1-ol;ethane |
| SMILES | C=C1CCC2CC([C@@]3(C)CC[C@H](O)C[C@@H]3CCO)CCC12C.CC |
| InChI | InChI=1S/C20H34O2.C2H6/c1-14-4-5-15-12-16(6-9-19(14,15)2)20(3)10-7-18(22)13-17(20)8-11-21;1-2/h15-18,21-22H,1,4-13H2,2-3H3;1-2H3/t15?,16?,17-,18-,19?,20+;/m0./s1 |
| InChIKey | DXZQTFJLFBSYPZ-MGOHUFRQSA-N |
| XLogP | 5.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|