C22H35NO2S — CID 144726530
[6-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-2,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-5-yl]methanol;methanol (PubChem CID 144726530) has the molecular formula C22H35NO2S and a molecular weight of 377.59 g/mol. Its IUPAC name is [6-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-2,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-5-yl]methanol;methanol.
| Compound Name | [6-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-2,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-5-yl]methanol;methanol |
|---|---|
| PubChem CID | 144726530 |
| Molecular Formula | C22H35NO2S |
| Molecular Weight | 377.59 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | [6-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-2,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-5-yl]methanol;methanol |
| SMILES | C=C1CCC2CC(C3(C)Cc4sc(C)nc4CC3CO)CCC12C.CO |
| InChI | InChI=1S/C21H31NOS.CH4O/c1-13-5-6-15-9-16(7-8-20(13,15)3)21(4)11-19-18(10-17(21)12-23)22-14(2)24-19;1-2/h15-17,23H,1,5-12H2,2-4H3;2H,1H3 |
| InChIKey | FRCYARBJORTFKV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|