C12H22N2S — CID 142576329
ethane;2,7,7-trimethyl-4,5,6,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine (PubChem CID 142576329) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is ethane;2,7,7-trimethyl-4,5,6,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine.
| Compound Name | ethane;2,7,7-trimethyl-4,5,6,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 142576329 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | ethane;2,7,7-trimethyl-4,5,6,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine |
| SMILES | CC.Cc1nc2c(s1)CC(C)(C)NCC2 |
| InChI | InChI=1S/C10H16N2S.C2H6/c1-7-12-8-4-5-11-10(2,3)6-9(8)13-7;1-2/h11H,4-6H2,1-3H3;1-2H3 |
| InChIKey | VWXWMKMMKWXAGR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |