C25H35NO2S — CID 123733947
2,6,13,13,21-pentamethyl-20-methylidene-12,14-dioxa-5-thia-7-azahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),6-diene (PubChem CID 123733947) has the molecular formula C25H35NO2S and a molecular weight of 413.63 g/mol. Its IUPAC name is 2,6,13,13,21-pentamethyl-20-methylidene-12,14-dioxa-5-thia-7-azahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),6-diene.
| Compound Name | 2,6,13,13,21-pentamethyl-20-methylidene-12,14-dioxa-5-thia-7-azahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),6-diene |
|---|---|
| PubChem CID | 123733947 |
| Molecular Formula | C25H35NO2S |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2,6,13,13,21-pentamethyl-20-methylidene-12,14-dioxa-5-thia-7-azahexacyclo[14.7.0.02,10.04,8.011,15.017,21]tricosa-4(8),6-diene |
| SMILES | C=C1CCC2C3C4OC(C)(C)OC4C4Cc5nc(C)sc5CC4(C)C3CCC12C |
| InChI | InChI=1S/C25H35NO2S/c1-13-7-8-15-20-16(9-10-24(13,15)5)25(6)12-19-18(26-14(2)29-19)11-17(25)21-22(20)28-23(3,4)27-21/h15-17,20-22H,1,7-12H2,2-6H3 |
| InChIKey | XXANFEGVBSWDAN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|