C24H34N2O3 — CID 155773263
(1S,2R,10S,11R,15R,16R,17S,19R,21S,22S)-2,13,13,21,22-pentamethyl-12,14,20-trioxa-6,7-diazaheptacyclo[14.8.0.02,10.04,8.011,15.017,22.019,21]tetracosa-4(8),5-diene (PubChem CID 155773263) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (1S,2R,10S,11R,15R,16R,17S,19R,21S,22S)-2,13,13,21,22-pentamethyl-12,14,20-trioxa-6,7-diazaheptacyclo[14.8.0.02,10.04,8.011,15.017,22.019,21]tetracosa-4(8),5-diene.
| Compound Name | (1S,2R,10S,11R,15R,16R,17S,19R,21S,22S)-2,13,13,21,22-pentamethyl-12,14,20-trioxa-6,7-diazaheptacyclo[14.8.0.02,10.04,8.011,15.017,22.019,21]tetracosa-4(8),5-diene |
|---|---|
| PubChem CID | 155773263 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (1S,2R,10S,11R,15R,16R,17S,19R,21S,22S)-2,13,13,21,22-pentamethyl-12,14,20-trioxa-6,7-diazaheptacyclo[14.8.0.02,10.04,8.011,15.017,22.019,21]tetracosa-4(8),5-diene |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@H]1Cc3[nH]ncc3C[C@]1(C)[C@H]1CC[C@@]3(C)[C@@H](C[C@H]4O[C@]43C)[C@H]21 |
| InChI | InChI=1S/C24H34N2O3/c1-21(2)28-19-15-8-16-12(11-25-26-16)10-22(15,3)13-6-7-23(4)14(18(13)20(19)29-21)9-17-24(23,5)27-17/h11,13-15,17-20H,6-10H2,1-5H3,(H,25,26)/t13-,14-,15+,17+,18+,19+,20+,22+,23-,24+/m0/s1 |
| InChIKey | OIBKSMCFTSKRRN-UVEAKTEUSA-N |
| XLogP | 3.87 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|