C29H46N2O3 — CID 145177908
ethyl (4R)-4-[(1S,11R,12R,14S,17R,18R)-11-ethyl-12-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl]pentanoate (PubChem CID 145177908) has the molecular formula C29H46N2O3 and a molecular weight of 470.70 g/mol. Its IUPAC name is ethyl (4R)-4-[(1S,11R,12R,14S,17R,18R)-11-ethyl-12-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(1S,11R,12R,14S,17R,18R)-11-ethyl-12-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl]pentanoate |
|---|---|
| PubChem CID | 145177908 |
| Molecular Formula | C29H46N2O3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | ethyl (4R)-4-[(1S,11R,12R,14S,17R,18R)-11-ethyl-12-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl]pentanoate |
| SMILES | CCOC(=O)CC[C@@H](C)[C@H]1CC[C@H]2C3C(O)[C@H](CC)C4Cc5[nH]ncc5CC4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H46N2O3/c1-6-19-23-14-24-18(16-30-31-24)15-29(23,5)22-12-13-28(4)20(9-10-21(28)26(22)27(19)33)17(3)8-11-25(32)34-7-2/h16-17,19-23,26-27,33H,6-15H2,1-5H3,(H,30,31)/t17-,19-,20-,21+,22+,23?,26?,27?,28-,29?/m1/s1 |
| InChIKey | JPFWTIJZRRAQEK-DUCCOOKKSA-N |
| XLogP | 5.57 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |