C31H50O6 — CID 142518276
diethyl 2-[(2R)-2-[(6R,7R,9S,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate (PubChem CID 142518276) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is diethyl 2-[(2R)-2-[(6R,7R,9S,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate.
| Compound Name | diethyl 2-[(2R)-2-[(6R,7R,9S,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate |
|---|---|
| PubChem CID | 142518276 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | diethyl 2-[(2R)-2-[(6R,7R,9S,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@@H](C)[C@H]1CC[C@H]2C3C(O)[C@H](CC)C4CC(=O)CCC4(C)[C@H]3CCC12C)C(=O)OCC |
| InChI | InChI=1S/C31H50O6/c1-7-20-25-17-19(32)12-14-31(25,6)24-13-15-30(5)22(10-11-23(30)26(24)27(20)33)18(4)16-21(28(34)36-8-2)29(35)37-9-3/h18,20-27,33H,7-17H2,1-6H3/t18-,20-,22-,23+,24+,25?,26?,27?,30?,31?/m1/s1 |
| InChIKey | SHZFLHBWXSECDO-MTAXRFMASA-N |
| XLogP | 5.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|