C28H48N2O2Si — CID 156687123
[(1E,3aS,4R,5S,7aS)-5-[(5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-1-ethylidene-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol (PubChem CID 156687123) has the molecular formula C28H48N2O2Si and a molecular weight of 472.79 g/mol. Its IUPAC name is [(1E,3aS,4R,5S,7aS)-5-[(5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-1-ethylidene-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol.
| Compound Name | [(1E,3aS,4R,5S,7aS)-5-[(5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-1-ethylidene-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol |
|---|---|
| PubChem CID | 156687123 |
| Molecular Formula | C28H48N2O2Si |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 472.35 |
| IUPAC Name | [(1E,3aS,4R,5S,7aS)-5-[(5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-1-ethylidene-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol |
| SMILES | C/C=C1\CC[C@H]2[C@H](CO)[C@@H]([C@@]3(C)Cc4cn[nH]c4C[C@@H]3CO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C28H48N2O2Si/c1-9-20-10-11-23-22(17-31)24(12-13-27(20,23)5)28(6)15-19-16-29-30-25(19)14-21(28)18-32-33(7,8)26(2,3)4/h9,16,21-24,31H,10-15,17-18H2,1-8H3,(H,29,30)/b20-9+/t21-,22+,23+,24+,27-,28+/m1/s1 |
| InChIKey | YUEAEIQUDHLRKT-ZAQJILGKSA-N |
| XLogP | 6.53 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|