C26H44N2O2Si — CID 174032193
(3aR,4R,5R,7aS)-5-[(5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol (PubChem CID 174032193) has the molecular formula C26H44N2O2Si and a molecular weight of 444.74 g/mol. Its IUPAC name is (3aR,4R,5R,7aS)-5-[(5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol.
| Compound Name | (3aR,4R,5R,7aS)-5-[(5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 174032193 |
| Molecular Formula | C26H44N2O2Si |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | (3aR,4R,5R,7aS)-5-[(5S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
| SMILES | C=C1CC[C@H]2[C@H](O)[C@@H]([C@@]3(C)Cc4cn[nH]c4C[C@@H]3CO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C26H44N2O2Si/c1-17-9-10-20-23(29)21(11-12-25(17,20)5)26(6)14-18-15-27-28-22(18)13-19(26)16-30-31(7,8)24(2,3)4/h15,19-21,23,29H,1,9-14,16H2,2-8H3,(H,27,28)/t19-,20+,21+,23+,25-,26+/m1/s1 |
| InChIKey | WWVKOUWRCVPEFW-VECSLAMNSA-N |
| XLogP | 5.90 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|