C21H34N4 — CID 175097357
(3aS,4R,5S,7aS)-5-[(5R,6S)-6-(aminomethyl)-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-N,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-amine (PubChem CID 175097357) has the molecular formula C21H34N4 and a molecular weight of 342.53 g/mol. Its IUPAC name is (3aS,4R,5S,7aS)-5-[(5R,6S)-6-(aminomethyl)-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-N,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-amine.
| Compound Name | (3aS,4R,5S,7aS)-5-[(5R,6S)-6-(aminomethyl)-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-N,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-amine |
|---|---|
| PubChem CID | 175097357 |
| Molecular Formula | C21H34N4 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | (3aS,4R,5S,7aS)-5-[(5R,6S)-6-(aminomethyl)-5-methyl-1,4,6,7-tetrahydroindazol-5-yl]-N,7a-dimethyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-amine |
| SMILES | C=C1CC[C@@H]2[C@H](NC)[C@H]([C@]3(C)Cc4cn[nH]c4C[C@@H]3CN)CC[C@]12C |
| InChI | InChI=1S/C21H34N4/c1-13-5-6-16-19(23-4)17(7-8-20(13,16)2)21(3)10-14-12-24-25-18(14)9-15(21)11-22/h12,15-17,19,23H,1,5-11,22H2,2-4H3,(H,24,25)/t15-,16-,17-,19+,20-,21-/m1/s1 |
| InChIKey | UTKQCKFUDHFBOH-PGGJBCGDSA-N |
| XLogP | 3.06 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|