C13H26N2 — CID 144881790
5,5-dimethyl-1,4,6,7-tetrahydroindazole;ethane (PubChem CID 144881790) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 5,5-dimethyl-1,4,6,7-tetrahydroindazole;ethane.
| Compound Name | 5,5-dimethyl-1,4,6,7-tetrahydroindazole;ethane |
|---|---|
| PubChem CID | 144881790 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 5,5-dimethyl-1,4,6,7-tetrahydroindazole;ethane |
| SMILES | CC.CC.CC1(C)CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C9H14N2.2C2H6/c1-9(2)4-3-8-7(5-9)6-10-11-8;2*1-2/h6H,3-5H2,1-2H3,(H,10,11);2*1-2H3 |
| InChIKey | FUPLPBOPMZASAS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |