C18H27IN4 — CID 162165555
6,6-dimethyl-1,4,5,7-tetrahydroindazole;3-iodo-6,6-dimethyl-1,4,5,7-tetrahydroindazole (PubChem CID 162165555) has the molecular formula C18H27IN4 and a molecular weight of 426.35 g/mol. Its IUPAC name is 6,6-dimethyl-1,4,5,7-tetrahydroindazole;3-iodo-6,6-dimethyl-1,4,5,7-tetrahydroindazole.
| Compound Name | 6,6-dimethyl-1,4,5,7-tetrahydroindazole;3-iodo-6,6-dimethyl-1,4,5,7-tetrahydroindazole |
|---|---|
| PubChem CID | 162165555 |
| Molecular Formula | C18H27IN4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 6,6-dimethyl-1,4,5,7-tetrahydroindazole;3-iodo-6,6-dimethyl-1,4,5,7-tetrahydroindazole |
| SMILES | CC1(C)CCc2c(I)n[nH]c2C1.CC1(C)CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C9H13IN2.C9H14N2/c1-9(2)4-3-6-7(5-9)11-12-8(6)10;1-9(2)4-3-7-6-10-11-8(7)5-9/h3-5H2,1-2H3,(H,11,12);6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | ZNBPXUYQOSMTJT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|