C18H24N4O — CID 144999837
1-[3-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)phenyl]-3-ethylurea (PubChem CID 144999837) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-[3-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)phenyl]-3-ethylurea.
| Compound Name | 1-[3-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 144999837 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[3-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cccc(-c2n[nH]c3c2CCC(C)(C)C3)c1 |
| InChI | InChI=1S/C18H24N4O/c1-4-19-17(23)20-13-7-5-6-12(10-13)16-14-8-9-18(2,3)11-15(14)21-22-16/h5-7,10H,4,8-9,11H2,1-3H3,(H,21,22)(H2,19,20,23) |
| InChIKey | ORPXSBLGPMACJG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |